What is the structure of 3 Ethoxyhexane?
Identification of (3S)-3-ethoxyhexane Chemical Compound
| Chemical Formula | C8H18O |
|---|---|
| IUPAC Name | (3S)-3-ethoxyhexane |
| SMILES String | CCCC(CC)OCC |
| InChI | InChI=1S/C8H18O/c1-4-7-8(5-2)9-6-3/h8H,4-7H2,1-3H3/t8-/m0/s1 |
| InChIKey | USFQPQJCAAGKCS-QMMMGPOBSA-N |
What is the structure of 3 bromo 3 Ethylhexane?
3-Bromo-3-ethylhexane
| PubChem CID | 54282075 |
|---|---|
| Structure | Find Similar Structures |
| Molecular Formula | C8H17Br |
| Molecular Weight | 193.12 |
| Dates | Modify 2022-05-28 Create 2011-12-04 |
What is the structure of 3 Bromobutanal?
Identification of 3-bromobutanal Chemical Compound
| Chemical Formula | C4H7BrO |
|---|---|
| Molecular Weight | 151.00178 g/mol |
| IUPAC Name | 3-bromobutanal |
| SMILES String | CC(Br)CC=O |
| InChI | InChI=1S/C4H7BrO/c1-4(5)2-3-6/h3-4H,2H2,1H3 |
What is the structure of 3 Pentenal?
3-Pentanol
| PubChem CID | 11428 |
|---|---|
| Structure | Find Similar Structures |
| Chemical Safety | Laboratory Chemical Safety Summary (LCSS) Datasheet |
| Molecular Formula | C5H12O or CH3CH2CHOHCH2CH3 |
| Synonyms | 3-PENTANOL 584-02-1 Pentan-3-ol Diethyl carbinol Pentanol-3 More… |
What is the structure of 3 Methylhexane?
C7H163-Methylhexane / Formula
What is the structural formula for 3 Ethylhexane?
C8H18
3-Ethylhexane | C8H18 – PubChem.
What is the Iupac name of acetophenone?
1-Phenylethan-1-one
Acetophenone
| Names | |
|---|---|
| Preferred IUPAC name 1-Phenylethan-1-one | |
| Other names Acetophenone Phenylethanone Phenylacetone Methyl phenyl ketone | |
| Identifiers | |
| CAS Number | 98-86-2 |
Is 3-methylhexane R or S?
3-Methylhexane is a branched hydrocarbon with two enantiomers. It is one of the isomers of heptane. The molecule is chiral, and is one of the two isomers of heptane to have this property, the other being its structural isomer 2,3-Dimethylpentane. The enantiomers are (R)-3-methylhexane and (S)-3-methylhexane.
What does 3-Ethylhexane look like?
3-Ethylhexane | C8H18 – PubChem.
What is the structure of 3-Ethylhexane?
Identification of 3-ETHYLHEXANE Chemical Compound
| Chemical Formula | C8H18 |
|---|---|
| Molecular Weight | 114.22852 g/mol |
| IUPAC Name | 3-ethylhexane |
| SMILES String | CCCC(CC)CC |
| InChI | InChI=1S/C8H18/c1-4-7-8(5-2)6-3/h8H,4-7H2,1-3H3 |
What does 3 Ethylhexane look like?
What is the structure of acetophenone?
C8H8OAcetophenone / Formula
Why is acetophenone called acetophenone?
As indicated by the name for this compound, acetophenone represents a ketone, a type of carbonyl group with two non-hydrogen substituents. Acetophenone represents the simplest ketone derivative of benzene.
Why is pentanal called valeraldehyde?
Pentanal (also called valeraldehyde) is the organic compound is an alkyl aldehyde, molecular formula C5H10O. It is used in flavorings, resin chemistry, and rubber accelerators. Its smell is described as fermented, bready, fruity, nutty, berry….Pentanal.
| Names | |
|---|---|
| Related aldehydes | Butyraldehyde Hexanal |
How many structural isomers are there for C5H12O?
8 isomers
There are total 8 isomers possible with molecular formula C5H12O which are monohydric alcohols i.e with one OH group.